C27H28FN5O4 — CID 46073738
[4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 46073738) has the molecular formula C27H28FN5O4 and a molecular weight of 505.55 g/mol. Its IUPAC name is [4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46073738 |
| Molecular Formula | C27H28FN5O4 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | [4-(2-fluorophenoxy)-2-(4-methylpiperidin-1-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCc3nc(N4CCC(C)CC4)nc(Oc4ccccc4F)c3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H28FN5O4/c1-17-9-12-31(13-10-17)27-29-22-11-14-32(26(34)19-8-7-18(2)23(15-19)33(35)36)16-20(22)25(30-27)37-24-6-4-3-5-21(24)28/h3-8,15,17H,9-14,16H2,1-2H3 |
| InChIKey | GHUHIZSSESDYRT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|