C22H28N6O4 — CID 42870829
[4-[ethyl(methyl)amino]-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 42870829) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is [4-[ethyl(methyl)amino]-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [4-[ethyl(methyl)amino]-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42870829 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [4-[ethyl(methyl)amino]-2-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | CCN(C)c1nc(N2CCOCC2)nc2c1CN(C(=O)c1ccc(C)c([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C22H28N6O4/c1-4-25(3)20-17-14-27(21(29)16-6-5-15(2)19(13-16)28(30)31)8-7-18(17)23-22(24-20)26-9-11-32-12-10-26/h5-6,13H,4,7-12,14H2,1-3H3 |
| InChIKey | OROBXOBRTMDFLQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|