C26H26ClN5O5 — CID 42785761
(4-chloro-3-nitrophenyl)-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methanone (PubChem CID 42785761) has the molecular formula C26H26ClN5O5 and a molecular weight of 523.98 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methanone |
|---|---|
| PubChem CID | 42785761 |
| Molecular Formula | C26H26ClN5O5 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methanone |
| SMILES | COc1ccc(Cc2nc3c(c(N4CCOCC4)n2)CN(C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC3)cc1 |
| InChI | InChI=1S/C26H26ClN5O5/c1-36-19-5-2-17(3-6-19)14-24-28-22-8-9-31(16-20(22)25(29-24)30-10-12-37-13-11-30)26(33)18-4-7-21(27)23(15-18)32(34)35/h2-7,15H,8-14,16H2,1H3 |
| InChIKey | OTHZMLYPEIFVCV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|