C28H40N4O3 — CID 42784902
1-[2-[(3-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]nonan-1-one (PubChem CID 42784902) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is 1-[2-[(3-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]nonan-1-one.
| Compound Name | 1-[2-[(3-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]nonan-1-one |
|---|---|
| PubChem CID | 42784902 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 1-[2-[(3-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCc2nc(Cc3cccc(OC)c3)nc(N3CCOCC3)c2C1 |
| InChI | InChI=1S/C28H40N4O3/c1-3-4-5-6-7-8-12-27(33)32-14-13-25-24(21-32)28(31-15-17-35-18-16-31)30-26(29-25)20-22-10-9-11-23(19-22)34-2/h9-11,19H,3-8,12-18,20-21H2,1-2H3 |
| InChIKey | TWRSNVPKHJBIGP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|