C26H36N4O2 — CID 42785841
1-[2-[(3-methylphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]heptan-1-one (PubChem CID 42785841) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-[2-[(3-methylphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]heptan-1-one.
| Compound Name | 1-[2-[(3-methylphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]heptan-1-one |
|---|---|
| PubChem CID | 42785841 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 1-[2-[(3-methylphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCc2nc(Cc3cccc(C)c3)nc(N3CCOCC3)c2C1 |
| InChI | InChI=1S/C26H36N4O2/c1-3-4-5-6-10-25(31)30-12-11-23-22(19-30)26(29-13-15-32-16-14-29)28-24(27-23)18-21-9-7-8-20(2)17-21/h7-9,17H,3-6,10-16,18-19H2,1-2H3 |
| InChIKey | WADZREAJXUVAMU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|