C27H38N4O3 — CID 42785740
1-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one (PubChem CID 42785740) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is 1-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one.
| Compound Name | 1-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one |
|---|---|
| PubChem CID | 42785740 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 1-[2-[(4-methoxyphenyl)methyl]-4-morpholin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCc2nc(Cc3ccc(OC)cc3)nc(N3CCOCC3)c2C1 |
| InChI | InChI=1S/C27H38N4O3/c1-3-4-5-6-7-8-26(32)31-14-13-24-23(20-31)27(30-15-17-34-18-16-30)29-25(28-24)19-21-9-11-22(33-2)12-10-21/h9-12H,3-8,13-20H2,1-2H3 |
| InChIKey | QQWRFPHYWZOIHR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|