C25H26N6O8S — CID 3669000
4-[6-(2,4-dinitrophenyl)sulfonyl-2-[(3-methoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine (PubChem CID 3669000) has the molecular formula C25H26N6O8S and a molecular weight of 570.58 g/mol. Its IUPAC name is 4-[6-(2,4-dinitrophenyl)sulfonyl-2-[(3-methoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-(2,4-dinitrophenyl)sulfonyl-2-[(3-methoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 3669000 |
| Molecular Formula | C25H26N6O8S |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 4-[6-(2,4-dinitrophenyl)sulfonyl-2-[(3-methoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine |
| SMILES | COc1cccc(Cc2nc3c(c(N4CCOCC4)n2)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC3)c1 |
| InChI | InChI=1S/C25H26N6O8S/c1-38-19-4-2-3-17(13-19)14-24-26-21-7-8-29(16-20(21)25(27-24)28-9-11-39-12-10-28)40(36,37)23-6-5-18(30(32)33)15-22(23)31(34)35/h2-6,13,15H,7-12,14,16H2,1H3 |
| InChIKey | SEDIXKVHBAIKBX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 171.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|