C18H21N5O5S — CID 42786779
4-[2-methyl-6-(4-nitrophenyl)sulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine (PubChem CID 42786779) has the molecular formula C18H21N5O5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-[2-methyl-6-(4-nitrophenyl)sulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-methyl-6-(4-nitrophenyl)sulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 42786779 |
| Molecular Formula | C18H21N5O5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-[2-methyl-6-(4-nitrophenyl)sulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]morpholine |
| SMILES | Cc1nc2c(c(N3CCOCC3)n1)CN(S(=O)(=O)c1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C18H21N5O5S/c1-13-19-17-6-7-22(12-16(17)18(20-13)21-8-10-28-11-9-21)29(26,27)15-4-2-14(3-5-15)23(24)25/h2-5H,6-12H2,1H3 |
| InChIKey | LDSFJAOOXBKGOF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 118.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|