C25H28N4O5 — CID 46075644
2-[4-(2,3-dimethoxyphenyl)-1-methyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 46075644) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[4-(2,3-dimethoxyphenyl)-1-methyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(2,3-dimethoxyphenyl)-1-methyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 46075644 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[4-(2,3-dimethoxyphenyl)-1-methyl-2,5-dioxo-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-6-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | COc1cccc(C2NC(=O)N(C)C3=C2C(=O)N(CC(=O)Nc2ccc(C)c(C)c2)C3)c1OC |
| InChI | InChI=1S/C25H28N4O5/c1-14-9-10-16(11-15(14)2)26-20(30)13-29-12-18-21(24(29)31)22(27-25(32)28(18)3)17-7-6-8-19(33-4)23(17)34-5/h6-11,22H,12-13H2,1-5H3,(H,26,30)(H,27,32) |
| InChIKey | YCQXJHCYBHQCQA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |