C24H30N4O7 — CID 42873808
4-(2,3-dimethoxyphenyl)-6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 42873808) has the molecular formula C24H30N4O7 and a molecular weight of 486.53 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)-6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 4-(2,3-dimethoxyphenyl)-6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 42873808 |
| Molecular Formula | C24H30N4O7 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)-6-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | COc1cccc(C2NC(=O)N(C)C3=C2C(=O)N(CC(=O)N2CCC4(CC2)OCCO4)C3)c1OC |
| InChI | InChI=1S/C24H30N4O7/c1-26-16-13-28(14-18(29)27-9-7-24(8-10-27)34-11-12-35-24)22(30)19(16)20(25-23(26)31)15-5-4-6-17(32-2)21(15)33-3/h4-6,20H,7-14H2,1-3H3,(H,25,31) |
| InChIKey | JRPMKHOYIZLXLL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |