C29H33N5O7 — CID 98406261
(4R)-6-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-4-(2,3-dimethoxyphenyl)-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 98406261) has the molecular formula C29H33N5O7 and a molecular weight of 563.61 g/mol. Its IUPAC name is (4R)-6-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-4-(2,3-dimethoxyphenyl)-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | (4R)-6-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-4-(2,3-dimethoxyphenyl)-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 98406261 |
| Molecular Formula | C29H33N5O7 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | (4R)-6-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-4-(2,3-dimethoxyphenyl)-1-methyl-4,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | COc1cccc([C@H]2NC(=O)N(C)C3=C2C(=O)N(CC(=O)N2CCN(Cc4ccc5c(c4)OCO5)CC2)C3)c1OC |
| InChI | InChI=1S/C29H33N5O7/c1-31-20-15-34(28(36)25(20)26(30-29(31)37)19-5-4-6-22(38-2)27(19)39-3)16-24(35)33-11-9-32(10-12-33)14-18-7-8-21-23(13-18)41-17-40-21/h4-8,13,26H,9-12,14-17H2,1-3H3,(H,30,37)/t26-/m1/s1 |
| InChIKey | AALMAMOVBBTRAA-AREMUKBSSA-N |
| XLogP | 1.57 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |