C38H44N4O7 — CID 19055621
5-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(2,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 19055621) has the molecular formula C38H44N4O7 and a molecular weight of 668.79 g/mol. Its IUPAC name is 5-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(2,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(2,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 19055621 |
| Molecular Formula | C38H44N4O7 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | 5-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-9,9-dimethyl-6-(2,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cc(OC)c(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1OC |
| InChI | InChI=1S/C38H44N4O7/c1-38(2)19-27-36(29(43)20-38)37(25-17-32(46-4)33(47-5)18-31(25)45-3)42(28-9-7-6-8-26(28)39-27)22-35(44)41-14-12-40(13-15-41)21-24-10-11-30-34(16-24)49-23-48-30/h6-11,16-18,37,39H,12-15,19-23H2,1-5H3 |
| InChIKey | ZJCWFKQKLVNNJI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |