C24H24N4O2 — CID 46078705
5-benzyl-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide (PubChem CID 46078705) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-benzyl-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide.
| Compound Name | 5-benzyl-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 46078705 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 5-benzyl-4-oxo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCc2ccccc21)c1cc2n(n1)CCN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C24H24N4O2/c29-23(25-20-12-6-10-18-9-4-5-11-19(18)20)21-15-22-24(30)27(13-14-28(22)26-21)16-17-7-2-1-3-8-17/h1-5,7-9,11,15,20H,6,10,12-14,16H2,(H,25,29) |
| InChIKey | PDNJYYWYBLVKCW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |