C25H23F3N4O2 — CID 93008783
4-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-[[3-(trifluoromethyl)phenyl]methyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide (PubChem CID 93008783) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is 4-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-[[3-(trifluoromethyl)phenyl]methyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide.
| Compound Name | 4-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-[[3-(trifluoromethyl)phenyl]methyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 93008783 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-5-[[3-(trifluoromethyl)phenyl]methyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCc2ccccc21)c1cc2n(n1)CCN(Cc1cccc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C25H23F3N4O2/c26-25(27,28)18-8-3-5-16(13-18)15-31-11-12-32-22(24(31)34)14-21(30-32)23(33)29-20-10-4-7-17-6-1-2-9-19(17)20/h1-3,5-6,8-9,13-14,20H,4,7,10-12,15H2,(H,29,33)/t20-/m0/s1 |
| InChIKey | DEFCTGBTDXVWQZ-FQEVSTJZSA-N |
| XLogP | 4.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |