C26H34N6O5S — CID 46079330
N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(2-methoxyethyl)-4-nitrobenzenesulfonamide (PubChem CID 46079330) has the molecular formula C26H34N6O5S and a molecular weight of 542.66 g/mol. Its IUPAC name is N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(2-methoxyethyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(2-methoxyethyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 46079330 |
| Molecular Formula | C26H34N6O5S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(2-methoxyethyl)-4-nitrobenzenesulfonamide |
| SMILES | CCN1CCN(c2c(CN(CCOC)S(=O)(=O)c3ccc([N+](=O)[O-])cc3)c(C)nn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H34N6O5S/c1-4-28-14-16-29(17-15-28)26-25(21(2)27-31(26)22-8-6-5-7-9-22)20-30(18-19-37-3)38(35,36)24-12-10-23(11-13-24)32(33)34/h5-13H,4,14-20H2,1-3H3 |
| InChIKey | REDXDWVQOIXWNG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 114.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|