C29H47N5O2 — CID 93009255
(2S)-2-ethyl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(3-methoxypropyl)hexanamide (PubChem CID 93009255) has the molecular formula C29H47N5O2 and a molecular weight of 497.73 g/mol. Its IUPAC name is (2S)-2-ethyl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(3-methoxypropyl)hexanamide.
| Compound Name | (2S)-2-ethyl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(3-methoxypropyl)hexanamide |
|---|---|
| PubChem CID | 93009255 |
| Molecular Formula | C29H47N5O2 |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.37 |
| IUPAC Name | (2S)-2-ethyl-N-[[5-(4-ethylpiperazin-1-yl)-3-methyl-1-phenylpyrazol-4-yl]methyl]-N-(3-methoxypropyl)hexanamide |
| SMILES | CCCC[C@H](CC)C(=O)N(CCCOC)Cc1c(C)nn(-c2ccccc2)c1N1CCN(CC)CC1 |
| InChI | InChI=1S/C29H47N5O2/c1-6-9-14-25(7-2)29(35)33(17-13-22-36-5)23-27-24(4)30-34(26-15-11-10-12-16-26)28(27)32-20-18-31(8-3)19-21-32/h10-12,15-16,25H,6-9,13-14,17-23H2,1-5H3/t25-/m0/s1 |
| InChIKey | VAWWHYGNXIDBTG-VWLOTQADSA-N |
| XLogP | 4.90 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|