C34H38N4O2 — CID 46081124
(4-benzhydrylpiperazin-1-yl)-[6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone (PubChem CID 46081124) has the molecular formula C34H38N4O2 and a molecular weight of 534.70 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 46081124 |
| Molecular Formula | C34H38N4O2 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanone |
| SMILES | COc1c(C)cc(C2CCc3nc(C(=O)N4CCN(C(c5ccccc5)c5ccccc5)CC4)cn3C2)cc1C |
| InChI | InChI=1S/C34H38N4O2/c1-24-20-29(21-25(2)33(24)40-3)28-14-15-31-35-30(23-38(31)22-28)34(39)37-18-16-36(17-19-37)32(26-10-6-4-7-11-26)27-12-8-5-9-13-27/h4-13,20-21,23,28,32H,14-19,22H2,1-3H3 |
| InChIKey | BEIJHSJRKPQHHV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |