C26H38N4O2 — CID 129423376
(6S)-6-(4-methoxy-3,5-dimethylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 129423376) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is (6S)-6-(4-methoxy-3,5-dimethylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | (6S)-6-(4-methoxy-3,5-dimethylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129423376 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (6S)-6-(4-methoxy-3,5-dimethylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1c(C)cc([C@@H]2CCc3nc(C(=O)NCCCN4CCCC[C@H]4C)cn3C2)cc1C |
| InChI | InChI=1S/C26H38N4O2/c1-18-14-22(15-19(2)25(18)32-4)21-9-10-24-28-23(17-30(24)16-21)26(31)27-11-7-13-29-12-6-5-8-20(29)3/h14-15,17,20-21H,5-13,16H2,1-4H3,(H,27,31)/t20-,21-/m1/s1 |
| InChIKey | XKKFNCNJUALHDT-NHCUHLMSSA-N |
| XLogP | 4.23 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|