C26H30FN3O — CID 46081167
[4-(6-fluoro-2-phenylbenzimidazol-1-yl)piperidin-1-yl]-(4-methylcyclohexyl)methanone (PubChem CID 46081167) has the molecular formula C26H30FN3O and a molecular weight of 419.54 g/mol. Its IUPAC name is [4-(6-fluoro-2-phenylbenzimidazol-1-yl)piperidin-1-yl]-(4-methylcyclohexyl)methanone.
| Compound Name | [4-(6-fluoro-2-phenylbenzimidazol-1-yl)piperidin-1-yl]-(4-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 46081167 |
| Molecular Formula | C26H30FN3O |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | [4-(6-fluoro-2-phenylbenzimidazol-1-yl)piperidin-1-yl]-(4-methylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)N2CCC(n3c(-c4ccccc4)nc4ccc(F)cc43)CC2)CC1 |
| InChI | InChI=1S/C26H30FN3O/c1-18-7-9-20(10-8-18)26(31)29-15-13-22(14-16-29)30-24-17-21(27)11-12-23(24)28-25(30)19-5-3-2-4-6-19/h2-6,11-12,17-18,20,22H,7-10,13-16H2,1H3 |
| InChIKey | BNXLIFAABQTACB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |