C22H21F2N3O — CID 75145339
1-[4-(6-fluoro-2-methylbenzimidazol-1-yl)piperidin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one (PubChem CID 75145339) has the molecular formula C22H21F2N3O and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-[4-(6-fluoro-2-methylbenzimidazol-1-yl)piperidin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(6-fluoro-2-methylbenzimidazol-1-yl)piperidin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75145339 |
| Molecular Formula | C22H21F2N3O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[4-(6-fluoro-2-methylbenzimidazol-1-yl)piperidin-1-yl]-3-(2-fluorophenyl)prop-2-en-1-one |
| SMILES | Cc1nc2ccc(F)cc2n1C1CCN(C(=O)C=Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C22H21F2N3O/c1-15-25-20-8-7-17(23)14-21(20)27(15)18-10-12-26(13-11-18)22(28)9-6-16-4-2-3-5-19(16)24/h2-9,14,18H,10-13H2,1H3 |
| InChIKey | BQWNRIHEQUVBJK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|