C32H30Cl3N3O3 — CID 46081276
[4-[3-[bis(4-chlorophenyl)methoxy]propyl]piperazin-1-yl]-[2-(4-chlorophenoxy)-3-pyridinyl]methanone (PubChem CID 46081276) has the molecular formula C32H30Cl3N3O3 and a molecular weight of 610.97 g/mol. Its IUPAC name is [4-[3-[bis(4-chlorophenyl)methoxy]propyl]piperazin-1-yl]-[2-(4-chlorophenoxy)-3-pyridinyl]methanone.
| Compound Name | [4-[3-[bis(4-chlorophenyl)methoxy]propyl]piperazin-1-yl]-[2-(4-chlorophenoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 46081276 |
| Molecular Formula | C32H30Cl3N3O3 |
| Molecular Weight | 610.97 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | [4-[3-[bis(4-chlorophenyl)methoxy]propyl]piperazin-1-yl]-[2-(4-chlorophenoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1cccnc1Oc1ccc(Cl)cc1)N1CCN(CCCOC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C32H30Cl3N3O3/c33-25-8-4-23(5-9-25)30(24-6-10-26(34)11-7-24)40-22-2-17-37-18-20-38(21-19-37)32(39)29-3-1-16-36-31(29)41-28-14-12-27(35)13-15-28/h1,3-16,30H,2,17-22H2 |
| InChIKey | FYWOHDZQFKCVQY-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.97 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|