C26H22ClN5O2 — CID 46081731
(6-chloro-3-pyridinyl)-[4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 46081731) has the molecular formula C26H22ClN5O2 and a molecular weight of 471.95 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-[4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (6-chloro-3-pyridinyl)-[4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46081731 |
| Molecular Formula | C26H22ClN5O2 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (6-chloro-3-pyridinyl)-[4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCN(c2nccc(-c3ccc(Oc4ccccc4)cc3)n2)CC1 |
| InChI | InChI=1S/C26H22ClN5O2/c27-24-11-8-20(18-29-24)25(33)31-14-16-32(17-15-31)26-28-13-12-23(30-26)19-6-9-22(10-7-19)34-21-4-2-1-3-5-21/h1-13,18H,14-17H2 |
| InChIKey | JRHTTXUZJPCVHF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|