C27H31N3O3 — CID 46082358
ethyl 1-[4-(2-ethylpiperidine-1-carbonyl)phenyl]-5-(2-methylphenyl)pyrazole-3-carboxylate (PubChem CID 46082358) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is ethyl 1-[4-(2-ethylpiperidine-1-carbonyl)phenyl]-5-(2-methylphenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[4-(2-ethylpiperidine-1-carbonyl)phenyl]-5-(2-methylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46082358 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | ethyl 1-[4-(2-ethylpiperidine-1-carbonyl)phenyl]-5-(2-methylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2C)n(-c2ccc(C(=O)N3CCCCC3CC)cc2)n1 |
| InChI | InChI=1S/C27H31N3O3/c1-4-21-11-8-9-17-29(21)26(31)20-13-15-22(16-14-20)30-25(23-12-7-6-10-19(23)3)18-24(28-30)27(32)33-5-2/h6-7,10,12-16,18,21H,4-5,8-9,11,17H2,1-3H3 |
| InChIKey | GNPOADSUYONKSV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |