C29H27N3O3 — CID 46082544
ethyl 1-[4-[bis(prop-2-enyl)carbamoyl]phenyl]-5-naphthalen-2-ylpyrazole-3-carboxylate (PubChem CID 46082544) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is ethyl 1-[4-[bis(prop-2-enyl)carbamoyl]phenyl]-5-naphthalen-2-ylpyrazole-3-carboxylate.
| Compound Name | ethyl 1-[4-[bis(prop-2-enyl)carbamoyl]phenyl]-5-naphthalen-2-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46082544 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | ethyl 1-[4-[bis(prop-2-enyl)carbamoyl]phenyl]-5-naphthalen-2-ylpyrazole-3-carboxylate |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(-n2nc(C(=O)OCC)cc2-c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C29H27N3O3/c1-4-17-31(18-5-2)28(33)22-13-15-25(16-14-22)32-27(20-26(30-32)29(34)35-6-3)24-12-11-21-9-7-8-10-23(21)19-24/h4-5,7-16,19-20H,1-2,6,17-18H2,3H3 |
| InChIKey | ARCFRPFOLBQIBP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|