C24H32N4O3 — CID 46084391
N-[(4-methoxyphenyl)methyl]-2-[4-(2-methylpentanoyl)piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 46084391) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[4-(2-methylpentanoyl)piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[4-(2-methylpentanoyl)piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46084391 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[4-(2-methylpentanoyl)piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CCCC(C)C(=O)N1CCN(c2ncccc2C(=O)NCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H32N4O3/c1-4-6-18(2)24(30)28-15-13-27(14-16-28)22-21(7-5-12-25-22)23(29)26-17-19-8-10-20(31-3)11-9-19/h5,7-12,18H,4,6,13-17H2,1-3H3,(H,26,29) |
| InChIKey | VZOIIMHNQJWGCV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |