C25H33N5O5 — CID 46084667
ethyl 4-[[4-[3-[(4-methoxyphenyl)methylcarbamoyl]-2-pyridinyl]piperazine-1-carbonyl]amino]butanoate (PubChem CID 46084667) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is ethyl 4-[[4-[3-[(4-methoxyphenyl)methylcarbamoyl]-2-pyridinyl]piperazine-1-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[4-[3-[(4-methoxyphenyl)methylcarbamoyl]-2-pyridinyl]piperazine-1-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 46084667 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | ethyl 4-[[4-[3-[(4-methoxyphenyl)methylcarbamoyl]-2-pyridinyl]piperazine-1-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)N1CCN(c2ncccc2C(=O)NCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H33N5O5/c1-3-35-22(31)7-5-13-27-25(33)30-16-14-29(15-17-30)23-21(6-4-12-26-23)24(32)28-18-19-8-10-20(34-2)11-9-19/h4,6,8-12H,3,5,7,13-18H2,1-2H3,(H,27,33)(H,28,32) |
| InChIKey | LJZGVYCPSDUKKI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|