C25H28ClN5O5S — CID 46084570
2-[4-[(6-chloro-2-pyridinyl)sulfonyl]piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 46084570) has the molecular formula C25H28ClN5O5S and a molecular weight of 546.05 g/mol. Its IUPAC name is 2-[4-[(6-chloro-2-pyridinyl)sulfonyl]piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-[4-[(6-chloro-2-pyridinyl)sulfonyl]piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46084570 |
| Molecular Formula | C25H28ClN5O5S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 2-[4-[(6-chloro-2-pyridinyl)sulfonyl]piperazin-1-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cccnc2N2CCN(S(=O)(=O)c3cccc(Cl)n3)CC2)cc1OC |
| InChI | InChI=1S/C25H28ClN5O5S/c1-35-20-9-8-18(17-21(20)36-2)10-12-28-25(32)19-5-4-11-27-24(19)30-13-15-31(16-14-30)37(33,34)23-7-3-6-22(26)29-23/h3-9,11,17H,10,12-16H2,1-2H3,(H,28,32) |
| InChIKey | HMSHYTXJRMTKQB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|