C37H28N4O3S — CID 46085307
2-[[4-(oxolan-2-ylmethyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]anthracene-9,10-dione (PubChem CID 46085307) has the molecular formula C37H28N4O3S and a molecular weight of 608.72 g/mol. Its IUPAC name is 2-[[4-(oxolan-2-ylmethyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]anthracene-9,10-dione.
| Compound Name | 2-[[4-(oxolan-2-ylmethyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 46085307 |
| Molecular Formula | C37H28N4O3S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 2-[[4-(oxolan-2-ylmethyl)-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(CSc3nnc(-c4cc(-c5ccccc5)nc5ccccc45)n3CC3CCCO3)ccc21 |
| InChI | InChI=1S/C37H28N4O3S/c42-34-27-13-4-5-14-28(27)35(43)30-19-23(16-17-29(30)34)22-45-37-40-39-36(41(37)21-25-11-8-18-44-25)31-20-33(24-9-2-1-3-10-24)38-32-15-7-6-12-26(31)32/h1-7,9-10,12-17,19-20,25H,8,11,18,21-22H2 |
| InChIKey | WYUIGQMYYNEAJP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|