C27H31N5O2 — CID 46086567
3-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(2-methylpropyl)pyrazol-1-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 46086567) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 3-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(2-methylpropyl)pyrazol-1-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(2-methylpropyl)pyrazol-1-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 46086567 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 3-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-5-(2-methylpropyl)pyrazol-1-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | Cc1nnc(-c2cc(CC(C)C)n(-c3cccc(C(=O)NCCCCc4ccccc4)c3)n2)o1 |
| InChI | InChI=1S/C27H31N5O2/c1-19(2)16-24-18-25(27-30-29-20(3)34-27)31-32(24)23-14-9-13-22(17-23)26(33)28-15-8-7-12-21-10-5-4-6-11-21/h4-6,9-11,13-14,17-19H,7-8,12,15-16H2,1-3H3,(H,28,33) |
| InChIKey | ILKJWDLTEVTYBB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|