About 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide
2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide (PubChem CID 46090185) has the molecular formula C23H29NO3
and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide.
Molecular Properties
| Compound Name | 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide |
| PubChem CID | 46090185 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)NCC1Cc2cc(Oc3ccccc3)ccc2O1 |
| InChI | InChI=1S/C23H29NO3/c1-3-5-9-17(4-2)23(25)24-16-21-15-18-14-20(12-13-22(18)27-21)26-19-10-7-6-8-11-19/h6-8,10-14,17,21H,3-5,9,15-16H2,1-2H3,(H,24,25) |
| InChIKey | KHZKQTNPDZPRQR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide?
The IUPAC name of 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide (CID 46090185) is 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide.
What is the SMILES notation for 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide?
The canonical SMILES for 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide is CCCCC(CC)C(=O)NCC1Cc2cc(Oc3ccccc3)ccc2O1.
What is the InChIKey of 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide?
The InChIKey is KHZKQTNPDZPRQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO3/c1-3-5-9-17(4-2)23(25)24-16-21-15-18-14-20(12-13-22(18)27-21)26-19-10-7-6-8-11-19/h6-8,10-14,17,21H,3-5,9,15-16H2,1-2H3,(H,24,25).
What are the key properties of 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide?
2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide has a molecular weight of 367.49 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-[(5-phenoxy-2,3-dihydro-1-benzofuran-2-yl)methyl]hexanamide is sourced from PubChem (CID 46090185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).