C27H28N4O2 — CID 46090692
1-tert-butyl-N-[4-[6-(3-methoxyphenyl)-2-pyridinyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 46090692) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-tert-butyl-N-[4-[6-(3-methoxyphenyl)-2-pyridinyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[4-[6-(3-methoxyphenyl)-2-pyridinyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46090692 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-tert-butyl-N-[4-[6-(3-methoxyphenyl)-2-pyridinyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | COc1cccc(-c2cccc(-c3ccc(NC(=O)c4cc(C)n(C(C)(C)C)n4)cc3)n2)c1 |
| InChI | InChI=1S/C27H28N4O2/c1-18-16-25(30-31(18)27(2,3)4)26(32)28-21-14-12-19(13-15-21)23-10-7-11-24(29-23)20-8-6-9-22(17-20)33-5/h6-17H,1-5H3,(H,28,32) |
| InChIKey | GWWQUCDECUKCLZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |