C28H30ClN3O5 — CID 46091196
methyl 4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzoate (PubChem CID 46091196) has the molecular formula C28H30ClN3O5 and a molecular weight of 524.02 g/mol. Its IUPAC name is methyl 4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzoate |
|---|---|
| PubChem CID | 46091196 |
| Molecular Formula | C28H30ClN3O5 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | methyl 4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(CN2CCN(C(=O)c3ccc(Cl)nc3)CC2)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C28H30ClN3O5/c1-35-24-5-3-4-22(16-24)25(37-19-20-6-8-21(9-7-20)28(34)36-2)18-31-12-14-32(15-13-31)27(33)23-10-11-26(29)30-17-23/h3-11,16-17,25H,12-15,18-19H2,1-2H3 |
| InChIKey | LQYKMEXYRIGQJZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|