C27H27ClN4O3 — CID 46092437
4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzonitrile (PubChem CID 46092437) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is 4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzonitrile.
| Compound Name | 4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 46092437 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 4-[[2-[4-(6-chloropyridine-3-carbonyl)piperazin-1-yl]-1-(3-methoxyphenyl)ethoxy]methyl]benzonitrile |
| SMILES | COc1cccc(C(CN2CCN(C(=O)c3ccc(Cl)nc3)CC2)OCc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C27H27ClN4O3/c1-34-24-4-2-3-22(15-24)25(35-19-21-7-5-20(16-29)6-8-21)18-31-11-13-32(14-12-31)27(33)23-9-10-26(28)30-17-23/h2-10,15,17,25H,11-14,18-19H2,1H3 |
| InChIKey | NJPAYYUCHOVJOH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|