C25H27F4N3O2S2 — CID 46096413
1-cyclopentyl-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole (PubChem CID 46096413) has the molecular formula C25H27F4N3O2S2 and a molecular weight of 541.64 g/mol. Its IUPAC name is 1-cyclopentyl-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole.
| Compound Name | 1-cyclopentyl-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole |
|---|---|
| PubChem CID | 46096413 |
| Molecular Formula | C25H27F4N3O2S2 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1-cyclopentyl-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc3c(c2)nc(SCc2cc(F)c(F)c(F)c2F)n3C2CCCC2)C1 |
| InChI | InChI=1S/C25H27F4N3O2S2/c1-15-5-4-10-31(13-15)36(33,34)18-8-9-21-20(12-18)30-25(32(21)17-6-2-3-7-17)35-14-16-11-19(26)23(28)24(29)22(16)27/h8-9,11-12,15,17H,2-7,10,13-14H2,1H3 |
| InChIKey | DCSIAPIUCZQIJB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|