C25H28F3N3O2S2 — CID 92819610
1-cyclopentyl-5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazole (PubChem CID 92819610) has the molecular formula C25H28F3N3O2S2 and a molecular weight of 523.65 g/mol. Its IUPAC name is 1-cyclopentyl-5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazole.
| Compound Name | 1-cyclopentyl-5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazole |
|---|---|
| PubChem CID | 92819610 |
| Molecular Formula | C25H28F3N3O2S2 |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 1-cyclopentyl-5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazole |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)c2ccc3c(c2)nc(SCc2ccc(F)c(F)c2F)n3C2CCCC2)C1 |
| InChI | InChI=1S/C25H28F3N3O2S2/c1-16-5-4-12-30(14-16)35(32,33)19-9-11-22-21(13-19)29-25(31(22)18-6-2-3-7-18)34-15-17-8-10-20(26)24(28)23(17)27/h8-11,13,16,18H,2-7,12,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | ZLWNWCMJUVJXGN-MRXNPFEDSA-N |
| XLogP | 6.28 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|