C18H18N2O2S — CID 46096812
3-methyl-N-(3-phenylpropyl)-5-thiophen-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 46096812) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-methyl-N-(3-phenylpropyl)-5-thiophen-2-yl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-methyl-N-(3-phenylpropyl)-5-thiophen-2-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46096812 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-methyl-N-(3-phenylpropyl)-5-thiophen-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(-c2cccs2)c1C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-13-16(17(22-20-13)15-10-6-12-23-15)18(21)19-11-5-9-14-7-3-2-4-8-14/h2-4,6-8,10,12H,5,9,11H2,1H3,(H,19,21) |
| InChIKey | ZNXRKPAVNXHBSK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|