C22H22N2O4 — CID 46096819
5-(1,3-benzodioxol-5-yl)-3-methyl-N-(4-phenylbutyl)-1,2-oxazole-4-carboxamide (PubChem CID 46096819) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-methyl-N-(4-phenylbutyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-methyl-N-(4-phenylbutyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46096819 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-methyl-N-(4-phenylbutyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(-c2ccc3c(c2)OCO3)c1C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O4/c1-15-20(22(25)23-12-6-5-9-16-7-3-2-4-8-16)21(28-24-15)17-10-11-18-19(13-17)27-14-26-18/h2-4,7-8,10-11,13H,5-6,9,12,14H2,1H3,(H,23,25) |
| InChIKey | UJYBWTJGDFYOOU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|