C20H19N5O2 — CID 46097578
6-(4-methoxyphenyl)-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 46097578) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-(4-methoxyphenyl)-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 46097578 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 6-(4-methoxyphenyl)-N-(2-phenoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COc1ccc(-c2cnc3ncnn3c2NCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C20H19N5O2/c1-26-16-9-7-15(8-10-16)18-13-22-20-23-14-24-25(20)19(18)21-11-12-27-17-5-3-2-4-6-17/h2-10,13-14,21H,11-12H2,1H3 |
| InChIKey | PDQFKHMSZRYHDC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|