C28H33N3O3 — CID 46097628
ethyl 5-(4-ethylphenyl)-1-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrazole-3-carboxylate (PubChem CID 46097628) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is ethyl 5-(4-ethylphenyl)-1-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-ethylphenyl)-1-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46097628 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | ethyl 5-(4-ethylphenyl)-1-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(CC)cc2)n(C2CCN(C(=O)CCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C28H33N3O3/c1-3-21-10-13-23(14-11-21)26-20-25(28(33)34-4-2)29-31(26)24-16-18-30(19-17-24)27(32)15-12-22-8-6-5-7-9-22/h5-11,13-14,20,24H,3-4,12,15-19H2,1-2H3 |
| InChIKey | RPNVADMIQHEHDH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |