C26H31N3O — CID 92768050
(3R)-1-[4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-3-methylpentan-1-one (PubChem CID 92768050) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is (3R)-1-[4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-3-methylpentan-1-one.
| Compound Name | (3R)-1-[4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-3-methylpentan-1-one |
|---|---|
| PubChem CID | 92768050 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | (3R)-1-[4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-3-methylpentan-1-one |
| SMILES | CC[C@@H](C)CC(=O)N1CCC(n2nc(-c3ccccc3)cc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O/c1-3-20(2)18-26(30)28-16-14-23(15-17-28)29-25(22-12-8-5-9-13-22)19-24(27-29)21-10-6-4-7-11-21/h4-13,19-20,23H,3,14-18H2,1-2H3/t20-/m1/s1 |
| InChIKey | CQPNHHCPXXQFRN-HXUWFJFHSA-N |
| XLogP | 5.82 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |