C28H27N3O — CID 46704929
[4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-(4-methylphenyl)methanone (PubChem CID 46704929) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is [4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 46704929 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | [4-(3,5-diphenylpyrazol-1-yl)piperidin-1-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(n3nc(-c4ccccc4)cc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H27N3O/c1-21-12-14-24(15-13-21)28(32)30-18-16-25(17-19-30)31-27(23-10-6-3-7-11-23)20-26(29-31)22-8-4-2-5-9-22/h2-15,20,25H,16-19H2,1H3 |
| InChIKey | FZLKBLJYGFMLFS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |