C16H22N6O2 — CID 143294507
N-ethyl-4-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)piperidine-1-carbohydrazide (PubChem CID 143294507) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-ethyl-4-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)piperidine-1-carbohydrazide.
| Compound Name | N-ethyl-4-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)piperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 143294507 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-ethyl-4-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)piperidine-1-carbohydrazide |
| SMILES | CCN(N)C(=O)N1CCC(n2nc(-c3ccccc3)[nH]c2=O)CC1 |
| InChI | InChI=1S/C16H22N6O2/c1-2-21(17)16(24)20-10-8-13(9-11-20)22-15(23)18-14(19-22)12-6-4-3-5-7-12/h3-7,13H,2,8-11,17H2,1H3,(H,18,19,23) |
| InChIKey | OBEMGRATXCTDQX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|