C26H30N6O2S — CID 46098728
7-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 46098728) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is 7-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 46098728 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 7-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN(c3c(-c4ccccc4)cnc4ncnn34)CC2)c(C)c1C |
| InChI | InChI=1S/C26H30N6O2S/c1-17-18(2)20(4)24(21(5)19(17)3)35(33,34)31-13-11-30(12-14-31)25-23(22-9-7-6-8-10-22)15-27-26-28-16-29-32(25)26/h6-10,15-16H,11-14H2,1-5H3 |
| InChIKey | OFZVLAYIRSTVTG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |