C22H25N7O4S — CID 46098723
4-[[4-[6-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 46098723) has the molecular formula C22H25N7O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is 4-[[4-[6-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[4-[6-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 46098723 |
| Molecular Formula | C22H25N7O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 4-[[4-[6-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1ccc(-c2cnc3ncnn3c2N2CCCN(S(=O)(=O)c3c(C)noc3C)CC2)cc1 |
| InChI | InChI=1S/C22H25N7O4S/c1-15-20(16(2)33-26-15)34(30,31)28-10-4-9-27(11-12-28)21-19(13-23-22-24-14-25-29(21)22)17-5-7-18(32-3)8-6-17/h5-8,13-14H,4,9-12H2,1-3H3 |
| InChIKey | NVMSUTUPJMVGKO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 118.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |