C28H34N2O2S — CID 46099288
N-(cyclohexylmethyl)-3-[5-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)pyrrol-2-yl]propanamide (PubChem CID 46099288) has the molecular formula C28H34N2O2S and a molecular weight of 462.66 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-[5-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)pyrrol-2-yl]propanamide.
| Compound Name | N-(cyclohexylmethyl)-3-[5-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)pyrrol-2-yl]propanamide |
|---|---|
| PubChem CID | 46099288 |
| Molecular Formula | C28H34N2O2S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-(cyclohexylmethyl)-3-[5-(4-methoxyphenyl)-1-(4-methylsulfanylphenyl)pyrrol-2-yl]propanamide |
| SMILES | COc1ccc(-c2ccc(CCC(=O)NCC3CCCCC3)n2-c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C28H34N2O2S/c1-32-25-14-8-22(9-15-25)27-18-12-24(30(27)23-10-16-26(33-2)17-11-23)13-19-28(31)29-20-21-6-4-3-5-7-21/h8-12,14-18,21H,3-7,13,19-20H2,1-2H3,(H,29,31) |
| InChIKey | VWGYKBJXQZOYBP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|