C22H20F3NO2 — CID 151209311
2,2,2-trifluoro-1-[4-[2-(4-methoxyphenyl)-5-propylpyrrol-1-yl]phenyl]ethanone (PubChem CID 151209311) has the molecular formula C22H20F3NO2 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[2-(4-methoxyphenyl)-5-propylpyrrol-1-yl]phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[2-(4-methoxyphenyl)-5-propylpyrrol-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 151209311 |
| Molecular Formula | C22H20F3NO2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[2-(4-methoxyphenyl)-5-propylpyrrol-1-yl]phenyl]ethanone |
| SMILES | CCCc1ccc(-c2ccc(OC)cc2)n1-c1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F3NO2/c1-3-4-17-11-14-20(15-7-12-19(28-2)13-8-15)26(17)18-9-5-16(6-10-18)21(27)22(23,24)25/h5-14H,3-4H2,1-2H3 |
| InChIKey | NJYBTGYENLNISG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|