C32H33N3O2 — CID 46099467
3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide (PubChem CID 46099467) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 46099467 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCc2ccc(-c3ccc(C)cc3C)n2-c2ccc(CC#N)cc2)cc1 |
| InChI | InChI=1S/C32H33N3O2/c1-23-4-15-30(24(2)22-23)31-16-11-28(35(31)27-9-5-25(6-10-27)18-20-33)12-17-32(36)34-21-19-26-7-13-29(37-3)14-8-26/h4-11,13-16,22H,12,17-19,21H2,1-3H3,(H,34,36) |
| InChIKey | OKKRLUZMMBOILJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|