C30H27F2N3O — CID 46099473
3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3,5-difluorophenyl)methyl]propanamide (PubChem CID 46099473) has the molecular formula C30H27F2N3O and a molecular weight of 483.56 g/mol. Its IUPAC name is 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3,5-difluorophenyl)methyl]propanamide.
| Compound Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3,5-difluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 46099473 |
| Molecular Formula | C30H27F2N3O |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3,5-difluorophenyl)methyl]propanamide |
| SMILES | Cc1ccc(-c2ccc(CCC(=O)NCc3cc(F)cc(F)c3)n2-c2ccc(CC#N)cc2)c(C)c1 |
| InChI | InChI=1S/C30H27F2N3O/c1-20-3-10-28(21(2)15-20)29-11-8-27(35(29)26-6-4-22(5-7-26)13-14-33)9-12-30(36)34-19-23-16-24(31)18-25(32)17-23/h3-8,10-11,15-18H,9,12-13,19H2,1-2H3,(H,34,36) |
| InChIKey | OSSFORKDDFKKMY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|