C27H29N3O — CID 46099444
3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-cyclobutylpropanamide (PubChem CID 46099444) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-cyclobutylpropanamide.
| Compound Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-cyclobutylpropanamide |
|---|---|
| PubChem CID | 46099444 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-cyclobutylpropanamide |
| SMILES | Cc1ccc(-c2ccc(CCC(=O)NC3CCC3)n2-c2ccc(CC#N)cc2)c(C)c1 |
| InChI | InChI=1S/C27H29N3O/c1-19-6-13-25(20(2)18-19)26-14-11-24(12-15-27(31)29-22-4-3-5-22)30(26)23-9-7-21(8-10-23)16-17-28/h6-11,13-14,18,22H,3-5,12,15-16H2,1-2H3,(H,29,31) |
| InChIKey | OKAARTFHJRAJCT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|