C31H31N3O — CID 46099491
3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3-methylphenyl)methyl]propanamide (PubChem CID 46099491) has the molecular formula C31H31N3O and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3-methylphenyl)methyl]propanamide.
| Compound Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 46099491 |
| Molecular Formula | C31H31N3O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N-[(3-methylphenyl)methyl]propanamide |
| SMILES | Cc1cccc(CNC(=O)CCc2ccc(-c3ccc(C)cc3C)n2-c2ccc(CC#N)cc2)c1 |
| InChI | InChI=1S/C31H31N3O/c1-22-5-4-6-26(20-22)21-33-31(35)16-13-28-12-15-30(29-14-7-23(2)19-24(29)3)34(28)27-10-8-25(9-11-27)17-18-32/h4-12,14-15,19-20H,13,16-17,21H2,1-3H3,(H,33,35) |
| InChIKey | XYYROMPCGBANKU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|